| Name | Propargyl alcohol propoxylate |
| Synonyms | PAP ACP3 Propargul alcohol 4-Oxa-1-heptyn-6-ol 1-propynoxy-2-propanol Propargyl alcohol propoxylat 1-(2-Propynyloxy)-2-propanol Propargyl alcohol propoxylate 1-(prop-2-yn-1-yloxy)propan-2-ol PAP (Propargyl alcohol propoxylate) |
| CAS | 3973-17-9 |
| InChI | InChI=1/C6H10O2/c1-3-4-8-5-6(2)7/h1,6-7H,4-5H2,2H3 |
| Molecular Formula | C6H10O2 |
| Molar Mass | 114.14 |
| Density | 0.9801 |
| Boling Point | 40-41 °C(Press: 3 Torr) |
| Flash Point | 69°C |
| Vapor Presure | 0.274mmHg at 25°C |
| Appearance | buffered aqueous solution |
| pKa | 14.29±0.20(Predicted) |
| Storage Condition | -20°C |
| Refractive Index | 1.4439 |
| Use | Nickel plating brightener, leveling agent. |
| Electroplating intermediate | 1. Propoxypropargyl alcohol (PAP) is a condensate of propargyl alcohol and propylene oxide, and is one of the most commonly used components in nickel light agents. 2. As a leveling and rapid light exiting agent, it usually needs to be used in conjunction with BMP, PPS, PVSS, COSS, PESS or MOSS and auxiliary brightener. |
| use | nickel plating brightener, leveling agent. |